C25H44N6O5 — CID 10118275
2-methoxyethyl N-[N-[1-[(4-cyano-1-propylpiperidin-4-yl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate (PubChem CID 10118275) has the molecular formula C25H44N6O5 and a molecular weight of 508.66 g/mol. Its IUPAC name is 2-methoxyethyl N-[N-[1-[(4-cyano-1-propylpiperidin-4-yl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate.
| Compound Name | 2-methoxyethyl N-[N-[1-[(4-cyano-1-propylpiperidin-4-yl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate |
|---|---|
| PubChem CID | 10118275 |
| Molecular Formula | C25H44N6O5 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.34 |
| IUPAC Name | 2-methoxyethyl N-[N-[1-[(4-cyano-1-propylpiperidin-4-yl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate |
| SMILES | CCCN1CCC(C#N)(NC(=O)C(CC(C)(C)C)/N=C(\NC(=O)OCCOC)N2CCOCC2)CC1 |
| InChI | InChI=1S/C25H44N6O5/c1-6-9-30-10-7-25(19-26,8-11-30)29-21(32)20(18-24(2,3)4)27-22(31-12-14-35-15-13-31)28-23(33)36-17-16-34-5/h20H,6-18H2,1-5H3,(H,29,32)(H,27,28,33) |
| InChIKey | DNLPSABETBFDMW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|