C12H16O6 — CID 101182788
[(1S,4R,5S)-4,5-diacetyloxycyclohex-2-en-1-yl] acetate (PubChem CID 101182788) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is [(1S,4R,5S)-4,5-diacetyloxycyclohex-2-en-1-yl] acetate.
| Compound Name | [(1S,4R,5S)-4,5-diacetyloxycyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 101182788 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | [(1S,4R,5S)-4,5-diacetyloxycyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C[C@@H](OC(C)=O)[C@@H](OC(C)=O)C1 |
| InChI | InChI=1S/C12H16O6/c1-7(13)16-10-4-5-11(17-8(2)14)12(6-10)18-9(3)15/h4-5,10-12H,6H2,1-3H3/t10-,11-,12+/m1/s1 |
| InChIKey | ZUGHGXKLPQIFSR-UTUOFQBUSA-N |
| XLogP | 0.74 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|