C20H25NO4 — CID 101183115
(E,3S)-7-[(4S)-4-tert-butyl-2-oxo-1,3-oxazolidin-3-yl]-7-oxo-3-phenylhept-5-enal (PubChem CID 101183115) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is (E,3S)-7-[(4S)-4-tert-butyl-2-oxo-1,3-oxazolidin-3-yl]-7-oxo-3-phenylhept-5-enal.
| Compound Name | (E,3S)-7-[(4S)-4-tert-butyl-2-oxo-1,3-oxazolidin-3-yl]-7-oxo-3-phenylhept-5-enal |
|---|---|
| PubChem CID | 101183115 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (E,3S)-7-[(4S)-4-tert-butyl-2-oxo-1,3-oxazolidin-3-yl]-7-oxo-3-phenylhept-5-enal |
| SMILES | CC(C)(C)[C@H]1COC(=O)N1C(=O)/C=C/CC(CC=O)c1ccccc1 |
| InChI | InChI=1S/C20H25NO4/c1-20(2,3)17-14-25-19(24)21(17)18(23)11-7-10-16(12-13-22)15-8-5-4-6-9-15/h4-9,11,13,16-17H,10,12,14H2,1-3H3/b11-7+/t16?,17-/m1/s1 |
| InChIKey | UYEHUEGTYKXTNC-SAIGXWRGSA-N |
| XLogP | 3.70 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|