C22H31NO4 — CID 101183128
(4S)-4-tert-butyl-3-[(1S,2R,4S,6R)-2-hydroxy-2,4-dimethyl-6-phenylcyclohexanecarbonyl]-1,3-oxazolidin-2-one (PubChem CID 101183128) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is (4S)-4-tert-butyl-3-[(1S,2R,4S,6R)-2-hydroxy-2,4-dimethyl-6-phenylcyclohexanecarbonyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-tert-butyl-3-[(1S,2R,4S,6R)-2-hydroxy-2,4-dimethyl-6-phenylcyclohexanecarbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101183128 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | (4S)-4-tert-butyl-3-[(1S,2R,4S,6R)-2-hydroxy-2,4-dimethyl-6-phenylcyclohexanecarbonyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H]1C[C@@H](c2ccccc2)[C@H](C(=O)N2C(=O)OC[C@@H]2C(C)(C)C)[C@](C)(O)C1 |
| InChI | InChI=1S/C22H31NO4/c1-14-11-16(15-9-7-6-8-10-15)18(22(5,26)12-14)19(24)23-17(21(2,3)4)13-27-20(23)25/h6-10,14,16-18,26H,11-13H2,1-5H3/t14-,16-,17+,18+,22+/m0/s1 |
| InChIKey | NRRMWWCDOSVBDC-XJYKWNPCSA-N |
| XLogP | 3.96 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |