C14H26O3Si — CID 101183343
tert-butyl-[[(4S,6Z)-2-ethenyl-5,8-dihydro-4H-1,3-dioxocin-4-yl]oxy]-dimethylsilane (PubChem CID 101183343) has the molecular formula C14H26O3Si and a molecular weight of 270.44 g/mol. Its IUPAC name is tert-butyl-[[(4S,6Z)-2-ethenyl-5,8-dihydro-4H-1,3-dioxocin-4-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(4S,6Z)-2-ethenyl-5,8-dihydro-4H-1,3-dioxocin-4-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 101183343 |
| Molecular Formula | C14H26O3Si |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | tert-butyl-[[(4S,6Z)-2-ethenyl-5,8-dihydro-4H-1,3-dioxocin-4-yl]oxy]-dimethylsilane |
| SMILES | C=CC1OC/C=C\C[C@H](O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C14H26O3Si/c1-7-12-15-11-9-8-10-13(16-12)17-18(5,6)14(2,3)4/h7-9,12-13H,1,10-11H2,2-6H3/b9-8-/t12?,13-/m0/s1 |
| InChIKey | SDFMEYUXQVNRSW-COUHGGSKSA-N |
| XLogP | 3.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|