C12H15FO4 — CID 101183405
(2R,3S,4R)-6-(4-fluorophenyl)-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 101183405) has the molecular formula C12H15FO4 and a molecular weight of 242.25 g/mol. Its IUPAC name is (2R,3S,4R)-6-(4-fluorophenyl)-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2R,3S,4R)-6-(4-fluorophenyl)-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 101183405 |
| Molecular Formula | C12H15FO4 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | (2R,3S,4R)-6-(4-fluorophenyl)-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | OC[C@H]1OC(c2ccc(F)cc2)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H15FO4/c13-8-3-1-7(2-4-8)10-5-9(15)12(16)11(6-14)17-10/h1-4,9-12,14-16H,5-6H2/t9-,10?,11-,12+/m1/s1 |
| InChIKey | BTYGBEBSJWUDRN-WAAKLRNESA-N |
| XLogP | 0.37 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |