C27H34N4O4S — CID 10118382
methyl 6-[5-[cyclohexyl(methyl)carbamoyl]-2-(thiophene-2-carbonylamino)benzimidazol-1-yl]hexanoate (PubChem CID 10118382) has the molecular formula C27H34N4O4S and a molecular weight of 510.66 g/mol. Its IUPAC name is methyl 6-[5-[cyclohexyl(methyl)carbamoyl]-2-(thiophene-2-carbonylamino)benzimidazol-1-yl]hexanoate.
| Compound Name | methyl 6-[5-[cyclohexyl(methyl)carbamoyl]-2-(thiophene-2-carbonylamino)benzimidazol-1-yl]hexanoate |
|---|---|
| PubChem CID | 10118382 |
| Molecular Formula | C27H34N4O4S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | methyl 6-[5-[cyclohexyl(methyl)carbamoyl]-2-(thiophene-2-carbonylamino)benzimidazol-1-yl]hexanoate |
| SMILES | COC(=O)CCCCCn1c(NC(=O)c2cccs2)nc2cc(C(=O)N(C)C3CCCCC3)ccc21 |
| InChI | InChI=1S/C27H34N4O4S/c1-30(20-10-5-3-6-11-20)26(34)19-14-15-22-21(18-19)28-27(29-25(33)23-12-9-17-36-23)31(22)16-8-4-7-13-24(32)35-2/h9,12,14-15,17-18,20H,3-8,10-11,13,16H2,1-2H3,(H,28,29,33) |
| InChIKey | GQOHWYKBNOYIQV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|