C27H36N2O8 — CID 101183851
methyl (2S)-3-(1H-indol-3-yl)-2-[4-[(1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]butanoylamino]propanoate (PubChem CID 101183851) has the molecular formula C27H36N2O8 and a molecular weight of 516.59 g/mol. Its IUPAC name is methyl (2S)-3-(1H-indol-3-yl)-2-[4-[(1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]butanoylamino]propanoate.
| Compound Name | methyl (2S)-3-(1H-indol-3-yl)-2-[4-[(1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]butanoylamino]propanoate |
|---|---|
| PubChem CID | 101183851 |
| Molecular Formula | C27H36N2O8 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | methyl (2S)-3-(1H-indol-3-yl)-2-[4-[(1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]butanoylamino]propanoate |
| SMILES | COC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CCCC1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C27H36N2O8/c1-26(2)34-21-19(33-25-23(22(21)35-26)36-27(3,4)37-25)11-8-12-20(30)29-18(24(31)32-5)13-15-14-28-17-10-7-6-9-16(15)17/h6-7,9-10,14,18-19,21-23,25,28H,8,11-13H2,1-5H3,(H,29,30)/t18-,19?,21-,22-,23+,25+/m0/s1 |
| InChIKey | NEWXYLDEBMRHBG-BJZDRENHSA-N |
| XLogP | 2.93 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |