C13H24O3Si — CID 101184079
2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3-dihydropyran-4-one (PubChem CID 101184079) has the molecular formula C13H24O3Si and a molecular weight of 256.42 g/mol. Its IUPAC name is 2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3-dihydropyran-4-one.
| Compound Name | 2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 101184079 |
| Molecular Formula | C13H24O3Si |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3-dihydropyran-4-one |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)C1CC(=O)C=CO1 |
| InChI | InChI=1S/C13H24O3Si/c1-10(12-9-11(14)7-8-15-12)16-17(5,6)13(2,3)4/h7-8,10,12H,9H2,1-6H3/t10-,12?/m0/s1 |
| InChIKey | BLLQVTAJVPFFKI-NUHJPDEHSA-N |
| XLogP | 3.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|