C10H13BrO3 — CID 101184301
(1S,4S,5S)-4-(bromomethyl)-1,5-dimethyl-3,9-dioxatricyclo[3.3.1.02,4]nonan-6-one (PubChem CID 101184301) has the molecular formula C10H13BrO3 and a molecular weight of 261.11 g/mol. Its IUPAC name is (1S,4S,5S)-4-(bromomethyl)-1,5-dimethyl-3,9-dioxatricyclo[3.3.1.02,4]nonan-6-one.
| Compound Name | (1S,4S,5S)-4-(bromomethyl)-1,5-dimethyl-3,9-dioxatricyclo[3.3.1.02,4]nonan-6-one |
|---|---|
| PubChem CID | 101184301 |
| Molecular Formula | C10H13BrO3 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | (1S,4S,5S)-4-(bromomethyl)-1,5-dimethyl-3,9-dioxatricyclo[3.3.1.02,4]nonan-6-one |
| SMILES | C[C@@]12CCC(=O)[C@@](C)(O1)[C@@]1(CBr)OC12 |
| InChI | InChI=1S/C10H13BrO3/c1-8-4-3-6(12)9(2,14-8)10(5-11)7(8)13-10/h7H,3-5H2,1-2H3/t7?,8-,9+,10-/m0/s1 |
| InChIKey | IIPPCUWYAWJFLK-UPBARMNASA-N |
| XLogP | 1.43 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|