About (1E,3Z)-5-ethoxy-1-phenyl-N-prop-2-enylpenta-1,3-dien-3-amine
(1E,3Z)-5-ethoxy-1-phenyl-N-prop-2-enylpenta-1,3-dien-3-amine (PubChem CID 101184702) has the molecular formula C16H21NO
and a molecular weight of 243.35 g/mol. Its IUPAC name is (1E,3Z)-5-ethoxy-1-phenyl-N-prop-2-enylpenta-1,3-dien-3-amine.
Molecular Properties
| Compound Name | (1E,3Z)-5-ethoxy-1-phenyl-N-prop-2-enylpenta-1,3-dien-3-amine |
| PubChem CID | 101184702 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (1E,3Z)-5-ethoxy-1-phenyl-N-prop-2-enylpenta-1,3-dien-3-amine |
| SMILES | C=CCNC(=C\COCC)/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H21NO/c1-3-13-17-16(12-14-18-4-2)11-10-15-8-6-5-7-9-15/h3,5-12,17H,1,4,13-14H2,2H3/b11-10+,16-12- |
| InChIKey | PCXIFTRKWSLEDZ-ZBUTWXCBSA-N |
| XLogP | 3.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E,3Z)-5-ethoxy-1-phenyl-N-prop-2-enylpenta-1,3-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,3Z)-5-ethoxy-1-phenyl-N-prop-2-enylpenta-1,3-dien-3-amine?
The IUPAC name of (1E,3Z)-5-ethoxy-1-phenyl-N-prop-2-enylpenta-1,3-dien-3-amine (CID 101184702) is (1E,3Z)-5-ethoxy-1-phenyl-N-prop-2-enylpenta-1,3-dien-3-amine.
What is the SMILES notation for (1E,3Z)-5-ethoxy-1-phenyl-N-prop-2-enylpenta-1,3-dien-3-amine?
The canonical SMILES for (1E,3Z)-5-ethoxy-1-phenyl-N-prop-2-enylpenta-1,3-dien-3-amine is C=CCNC(=C\COCC)/C=C/c1ccccc1.
What is the InChIKey of (1E,3Z)-5-ethoxy-1-phenyl-N-prop-2-enylpenta-1,3-dien-3-amine?
The InChIKey is PCXIFTRKWSLEDZ-ZBUTWXCBSA-N. The full InChI is InChI=1S/C16H21NO/c1-3-13-17-16(12-14-18-4-2)11-10-15-8-6-5-7-9-15/h3,5-12,17H,1,4,13-14H2,2H3/b11-10+,16-12-.
What are the key properties of (1E,3Z)-5-ethoxy-1-phenyl-N-prop-2-enylpenta-1,3-dien-3-amine?
(1E,3Z)-5-ethoxy-1-phenyl-N-prop-2-enylpenta-1,3-dien-3-amine has a molecular weight of 243.35 g/mol, XLogP of 3.40, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,3Z)-5-ethoxy-1-phenyl-N-prop-2-enylpenta-1,3-dien-3-amine is sourced from PubChem (CID 101184702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).