C30H30N4O4 — CID 101184743
2,25-dioxa-7,20,35,36-tetrazapentacyclo[24.5.3.18,12.115,19.029,33]hexatriaconta-1(32),8,10,12(36),15(35),16,18,26(34),27,29(33),30-undecaene-6,21-dione (PubChem CID 101184743) has the molecular formula C30H30N4O4 and a molecular weight of 510.59 g/mol. Its IUPAC name is 2,25-dioxa-7,20,35,36-tetrazapentacyclo[24.5.3.18,12.115,19.029,33]hexatriaconta-1(32),8,10,12(36),15(35),16,18,26(34),27,29(33),30-undecaene-6,21-dione.
| Compound Name | 2,25-dioxa-7,20,35,36-tetrazapentacyclo[24.5.3.18,12.115,19.029,33]hexatriaconta-1(32),8,10,12(36),15(35),16,18,26(34),27,29(33),30-undecaene-6,21-dione |
|---|---|
| PubChem CID | 101184743 |
| Molecular Formula | C30H30N4O4 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 2,25-dioxa-7,20,35,36-tetrazapentacyclo[24.5.3.18,12.115,19.029,33]hexatriaconta-1(32),8,10,12(36),15(35),16,18,26(34),27,29(33),30-undecaene-6,21-dione |
| SMILES | O=C1CCCOc2ccc3ccc(cc3c2)OCCCC(=O)Nc2cccc(n2)CCc2cccc(n2)N1 |
| InChI | InChI=1S/C30H30N4O4/c35-29-9-3-17-37-25-15-11-21-12-16-26(20-22(21)19-25)38-18-4-10-30(36)34-28-8-2-6-24(32-28)14-13-23-5-1-7-27(31-23)33-29/h1-2,5-8,11-12,15-16,19-20H,3-4,9-10,13-14,17-18H2,(H,31,33,35)(H,32,34,36) |
| InChIKey | LWWBHXCKKZLPAF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |