C11H14N2O4S — CID 101184823
2-(3-benzyl-1,1-dioxothiazetidin-2-yl)-N-hydroxyacetamide (PubChem CID 101184823) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-(3-benzyl-1,1-dioxothiazetidin-2-yl)-N-hydroxyacetamide.
| Compound Name | 2-(3-benzyl-1,1-dioxothiazetidin-2-yl)-N-hydroxyacetamide |
|---|---|
| PubChem CID | 101184823 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-(3-benzyl-1,1-dioxothiazetidin-2-yl)-N-hydroxyacetamide |
| SMILES | O=C(CN1C(Cc2ccccc2)CS1(=O)=O)NO |
| InChI | InChI=1S/C11H14N2O4S/c14-11(12-15)7-13-10(8-18(13,16)17)6-9-4-2-1-3-5-9/h1-5,10,15H,6-8H2,(H,12,14) |
| InChIKey | ICBFTCOGEDTOGJ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|