C7H11N3 — CID 101185007
(1E,4E)-3-(2-iminoethylidene)penta-1,4-diene-1,5-diamine (PubChem CID 101185007) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is (1E,4E)-3-(2-iminoethylidene)penta-1,4-diene-1,5-diamine.
| Compound Name | (1E,4E)-3-(2-iminoethylidene)penta-1,4-diene-1,5-diamine |
|---|---|
| PubChem CID | 101185007 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | (1E,4E)-3-(2-iminoethylidene)penta-1,4-diene-1,5-diamine |
| SMILES | [H]/N=C/C=C(/C=C/N)/C=C/N |
| InChI | InChI=1S/C7H11N3/c8-4-1-7(2-5-9)3-6-10/h1-6,8H,9-10H2/b5-2+,6-3+,8-4+ |
| InChIKey | RQPKTOJNOSYUPS-RNYXWSOMSA-N |
| XLogP | 0.51 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|