C9H11Cl3O2 — CID 101185737
2-(2,2,2-trichloroacetyl)cycloheptan-1-one (PubChem CID 101185737) has the molecular formula C9H11Cl3O2 and a molecular weight of 257.54 g/mol. Its IUPAC name is 2-(2,2,2-trichloroacetyl)cycloheptan-1-one.
| Compound Name | 2-(2,2,2-trichloroacetyl)cycloheptan-1-one |
|---|---|
| PubChem CID | 101185737 |
| Molecular Formula | C9H11Cl3O2 |
| Molecular Weight | 257.54 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | 2-(2,2,2-trichloroacetyl)cycloheptan-1-one |
| SMILES | O=C1CCCCCC1C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H11Cl3O2/c10-9(11,12)8(14)6-4-2-1-3-5-7(6)13/h6H,1-5H2 |
| InChIKey | QPGMCGVFHYPKQK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|