C18H39BrO2Si2 — CID 101185870
(Z,4S,5R)-5-bromo-1-[tert-butyl(dimethyl)silyl]oxy-2-(trimethylsilylmethyl)oct-1-en-4-ol (PubChem CID 101185870) has the molecular formula C18H39BrO2Si2 and a molecular weight of 423.58 g/mol. Its IUPAC name is (Z,4S,5R)-5-bromo-1-[tert-butyl(dimethyl)silyl]oxy-2-(trimethylsilylmethyl)oct-1-en-4-ol.
| Compound Name | (Z,4S,5R)-5-bromo-1-[tert-butyl(dimethyl)silyl]oxy-2-(trimethylsilylmethyl)oct-1-en-4-ol |
|---|---|
| PubChem CID | 101185870 |
| Molecular Formula | C18H39BrO2Si2 |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (Z,4S,5R)-5-bromo-1-[tert-butyl(dimethyl)silyl]oxy-2-(trimethylsilylmethyl)oct-1-en-4-ol |
| SMILES | CCC[C@@H](Br)[C@@H](O)C/C(=C/O[Si](C)(C)C(C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C18H39BrO2Si2/c1-10-11-16(19)17(20)12-15(14-22(5,6)7)13-21-23(8,9)18(2,3)4/h13,16-17,20H,10-12,14H2,1-9H3/b15-13-/t16-,17+/m1/s1 |
| InChIKey | XGMIVTJNKJLFPK-AMCSTGOPSA-N |
| XLogP | 6.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|