C12H22O2 — CID 101185874
(2R,3S,6S)-4-methylidene-2,6-dipropyloxan-3-ol (PubChem CID 101185874) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (2R,3S,6S)-4-methylidene-2,6-dipropyloxan-3-ol.
| Compound Name | (2R,3S,6S)-4-methylidene-2,6-dipropyloxan-3-ol |
|---|---|
| PubChem CID | 101185874 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (2R,3S,6S)-4-methylidene-2,6-dipropyloxan-3-ol |
| SMILES | C=C1C[C@H](CCC)O[C@H](CCC)[C@H]1O |
| InChI | InChI=1S/C12H22O2/c1-4-6-10-8-9(3)12(13)11(14-10)7-5-2/h10-13H,3-8H2,1-2H3/t10-,11+,12-/m0/s1 |
| InChIKey | FOHNEZXBIKTOSN-TUAOUCFPSA-N |
| XLogP | 2.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|