C16H28O6Si — CID 101185893
methyl 2-[(2R,3R,4R)-3-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-pyran-2-yl]acetate (PubChem CID 101185893) has the molecular formula C16H28O6Si and a molecular weight of 344.48 g/mol. Its IUPAC name is methyl 2-[(2R,3R,4R)-3-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-pyran-2-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,4R)-3-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-pyran-2-yl]acetate |
|---|---|
| PubChem CID | 101185893 |
| Molecular Formula | C16H28O6Si |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | methyl 2-[(2R,3R,4R)-3-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-pyran-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1OC=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H28O6Si/c1-11(17)21-15-12(22-23(6,7)16(2,3)4)8-9-20-13(15)10-14(18)19-5/h8-9,12-13,15H,10H2,1-7H3/t12-,13-,15+/m1/s1 |
| InChIKey | NAQXMYBHSDRZEJ-NFAWXSAZSA-N |
| XLogP | 2.78 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|