C13H20O4 — CID 101186047
4-hydroxy-2,3-di(propan-2-yloxy)-4-prop-2-enylcyclobut-2-en-1-one (PubChem CID 101186047) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 4-hydroxy-2,3-di(propan-2-yloxy)-4-prop-2-enylcyclobut-2-en-1-one.
| Compound Name | 4-hydroxy-2,3-di(propan-2-yloxy)-4-prop-2-enylcyclobut-2-en-1-one |
|---|---|
| PubChem CID | 101186047 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 4-hydroxy-2,3-di(propan-2-yloxy)-4-prop-2-enylcyclobut-2-en-1-one |
| SMILES | C=CCC1(O)C(=O)C(OC(C)C)=C1OC(C)C |
| InChI | InChI=1S/C13H20O4/c1-6-7-13(15)11(14)10(16-8(2)3)12(13)17-9(4)5/h6,8-9,15H,1,7H2,2-5H3 |
| InChIKey | DSUDUUPQUZTLEI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|