C24H22O2S2 — CID 101186685
(2R,3R)-1,4-bis(naphthalen-2-ylsulfanyl)butane-2,3-diol (PubChem CID 101186685) has the molecular formula C24H22O2S2 and a molecular weight of 406.57 g/mol. Its IUPAC name is (2R,3R)-1,4-bis(naphthalen-2-ylsulfanyl)butane-2,3-diol.
| Compound Name | (2R,3R)-1,4-bis(naphthalen-2-ylsulfanyl)butane-2,3-diol |
|---|---|
| PubChem CID | 101186685 |
| Molecular Formula | C24H22O2S2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | (2R,3R)-1,4-bis(naphthalen-2-ylsulfanyl)butane-2,3-diol |
| SMILES | O[C@@H](CSc1ccc2ccccc2c1)[C@@H](O)CSc1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H22O2S2/c25-23(15-27-21-11-9-17-5-1-3-7-19(17)13-21)24(26)16-28-22-12-10-18-6-2-4-8-20(18)14-22/h1-14,23-26H,15-16H2/t23-,24-/m0/s1 |
| InChIKey | ACNVWOMQTATHHE-ZEQRLZLVSA-N |
| XLogP | 5.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |