C24H35F2NO2SSi — CID 101186860
N-but-2-ynyl-N-[4,4-difluoro-2-tri(propan-2-yl)silylbuta-2,3-dienyl]-4-methylbenzenesulfonamide (PubChem CID 101186860) has the molecular formula C24H35F2NO2SSi and a molecular weight of 467.70 g/mol. Its IUPAC name is N-but-2-ynyl-N-[4,4-difluoro-2-tri(propan-2-yl)silylbuta-2,3-dienyl]-4-methylbenzenesulfonamide.
| Compound Name | N-but-2-ynyl-N-[4,4-difluoro-2-tri(propan-2-yl)silylbuta-2,3-dienyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 101186860 |
| Molecular Formula | C24H35F2NO2SSi |
| Molecular Weight | 467.70 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | N-but-2-ynyl-N-[4,4-difluoro-2-tri(propan-2-yl)silylbuta-2,3-dienyl]-4-methylbenzenesulfonamide |
| SMILES | CC#CCN(CC(=C=C(F)F)[Si](C(C)C)(C(C)C)C(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H35F2NO2SSi/c1-9-10-15-27(30(28,29)22-13-11-21(8)12-14-22)17-23(16-24(25)26)31(18(2)3,19(4)5)20(6)7/h11-14,18-20H,15,17H2,1-8H3 |
| InChIKey | UPFVIGCGFSMIJI-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.70 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|