C32H33ClO4SeSi — CID 101187329
[(3S,3aR,4R,7Z,11aR)-4-[tert-butyl(dimethyl)silyl]oxy-2-oxo-3-phenylselanyl-5,6,9,10-tetradehydro-3a,4,11,11a-tetrahydro-1H-cyclopenta[10]annulen-3-yl] 3-chlorobenzoate (PubChem CID 101187329) has the molecular formula C32H33ClO4SeSi and a molecular weight of 624.11 g/mol. Its IUPAC name is [(3S,3aR,4R,7Z,11aR)-4-[tert-butyl(dimethyl)silyl]oxy-2-oxo-3-phenylselanyl-5,6,9,10-tetradehydro-3a,4,11,11a-tetrahydro-1H-cyclopenta[10]annulen-3-yl] 3-chlorobenzoate.
| Compound Name | [(3S,3aR,4R,7Z,11aR)-4-[tert-butyl(dimethyl)silyl]oxy-2-oxo-3-phenylselanyl-5,6,9,10-tetradehydro-3a,4,11,11a-tetrahydro-1H-cyclopenta[10]annulen-3-yl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 101187329 |
| Molecular Formula | C32H33ClO4SeSi |
| Molecular Weight | 624.11 g/mol |
| Exact Mass | 624.10 |
| IUPAC Name | [(3S,3aR,4R,7Z,11aR)-4-[tert-butyl(dimethyl)silyl]oxy-2-oxo-3-phenylselanyl-5,6,9,10-tetradehydro-3a,4,11,11a-tetrahydro-1H-cyclopenta[10]annulen-3-yl] 3-chlorobenzoate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C#C/C=C\C#CC[C@@H]2CC(=O)[C@@](OC(=O)c3cccc(Cl)c3)([Se]c3ccccc3)[C@H]21 |
| InChI | InChI=1S/C32H33ClO4SeSi/c1-31(2,3)39(4,5)37-27-20-13-8-6-7-10-15-23-22-28(34)32(29(23)27,38-26-18-11-9-12-19-26)36-30(35)24-16-14-17-25(33)21-24/h6,8-9,11-12,14,16-19,21,23,27,29H,15,22H2,1-5H3/b8-6-/t23-,27+,29-,32-/m1/s1 |
| InChIKey | HATHCNQKFIUKPZ-WLHKVFQWSA-N |
| XLogP | 5.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.11 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|