C35H58O4Si — CID 101187369
(2R)-2-[(1E,3Z,5R,7E,9E,11R,13S,14R,15S)-14-[tert-butyl(dimethyl)silyl]oxy-3-ethyl-5,9,11,13,15-pentamethyl-12-oxoheptadeca-1,3,7,9-tetraenyl]-2,3-dihydropyran-6-one (PubChem CID 101187369) has the molecular formula C35H58O4Si and a molecular weight of 570.93 g/mol. Its IUPAC name is (2R)-2-[(1E,3Z,5R,7E,9E,11R,13S,14R,15S)-14-[tert-butyl(dimethyl)silyl]oxy-3-ethyl-5,9,11,13,15-pentamethyl-12-oxoheptadeca-1,3,7,9-tetraenyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(1E,3Z,5R,7E,9E,11R,13S,14R,15S)-14-[tert-butyl(dimethyl)silyl]oxy-3-ethyl-5,9,11,13,15-pentamethyl-12-oxoheptadeca-1,3,7,9-tetraenyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 101187369 |
| Molecular Formula | C35H58O4Si |
| Molecular Weight | 570.93 g/mol |
| Exact Mass | 570.41 |
| IUPAC Name | (2R)-2-[(1E,3Z,5R,7E,9E,11R,13S,14R,15S)-14-[tert-butyl(dimethyl)silyl]oxy-3-ethyl-5,9,11,13,15-pentamethyl-12-oxoheptadeca-1,3,7,9-tetraenyl]-2,3-dihydropyran-6-one |
| SMILES | CCC(=C/[C@H](C)C/C=C/C(C)=C/[C@@H](C)C(=O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CC)/C=C/[C@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/C35H58O4Si/c1-13-27(5)34(39-40(11,12)35(8,9)10)29(7)33(37)28(6)23-25(3)17-15-18-26(4)24-30(14-2)21-22-31-19-16-20-32(36)38-31/h15-17,20-24,26-29,31,34H,13-14,18-19H2,1-12H3/b17-15+,22-21+,25-23+,30-24-/t26-,27+,28-,29-,31-,34-/m1/s1 |
| InChIKey | LVEAJNNQAIIGOO-JZNAVGIGSA-N |
| XLogP | 9.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.93 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|