C15H16O5 — CID 101187403
(1R,2R,6R,7R,8R)-11-acetylspiro[3-oxatricyclo[5.2.2.02,6]undec-10-ene-8,5'-oxolane]-2',9-dione (PubChem CID 101187403) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is (1R,2R,6R,7R,8R)-11-acetylspiro[3-oxatricyclo[5.2.2.02,6]undec-10-ene-8,5'-oxolane]-2',9-dione.
| Compound Name | (1R,2R,6R,7R,8R)-11-acetylspiro[3-oxatricyclo[5.2.2.02,6]undec-10-ene-8,5'-oxolane]-2',9-dione |
|---|---|
| PubChem CID | 101187403 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (1R,2R,6R,7R,8R)-11-acetylspiro[3-oxatricyclo[5.2.2.02,6]undec-10-ene-8,5'-oxolane]-2',9-dione |
| SMILES | CC(=O)C1=C[C@H]2C(=O)[C@@]3(CCC(=O)O3)[C@@H]1[C@H]1CCO[C@H]12 |
| InChI | InChI=1S/C15H16O5/c1-7(16)9-6-10-13-8(3-5-19-13)12(9)15(14(10)18)4-2-11(17)20-15/h6,8,10,12-13H,2-5H2,1H3/t8-,10-,12-,13-,15-/m1/s1 |
| InChIKey | NMEQIILYNDDSHD-LPXRMJKRSA-N |
| XLogP | 0.81 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |