C19H19NO5 — CID 101187810
(7S)-7-methyl-11-(3-phenylpropoxy)-8-oxa-4-azatricyclo[5.4.0.02,6]undec-10-ene-3,5,9-trione (PubChem CID 101187810) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is (7S)-7-methyl-11-(3-phenylpropoxy)-8-oxa-4-azatricyclo[5.4.0.02,6]undec-10-ene-3,5,9-trione.
| Compound Name | (7S)-7-methyl-11-(3-phenylpropoxy)-8-oxa-4-azatricyclo[5.4.0.02,6]undec-10-ene-3,5,9-trione |
|---|---|
| PubChem CID | 101187810 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (7S)-7-methyl-11-(3-phenylpropoxy)-8-oxa-4-azatricyclo[5.4.0.02,6]undec-10-ene-3,5,9-trione |
| SMILES | C[C@]12OC(=O)C=C(OCCCc3ccccc3)C1C1C(=O)NC(=O)C12 |
| InChI | InChI=1S/C19H19NO5/c1-19-15(14-16(19)18(23)20-17(14)22)12(10-13(21)25-19)24-9-5-8-11-6-3-2-4-7-11/h2-4,6-7,10,14-16H,5,8-9H2,1H3,(H,20,22,23)/t14?,15?,16?,19-/m0/s1 |
| InChIKey | JBJJHBWPBZLMDI-MHLNYNPLSA-N |
| XLogP | 1.35 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|