C16H17NO — CID 101188166
6-aminotricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaen-5-ol (PubChem CID 101188166) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is 6-aminotricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaen-5-ol.
| Compound Name | 6-aminotricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaen-5-ol |
|---|---|
| PubChem CID | 101188166 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 6-aminotricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaen-5-ol |
| SMILES | Nc1c2ccc(c1O)CCc1ccc(cc1)CC2 |
| InChI | InChI=1S/C16H17NO/c17-15-13-7-5-11-1-3-12(4-2-11)6-8-14(10-9-13)16(15)18/h1-4,9-10,18H,5-8,17H2 |
| InChIKey | VLYORPNAKUHPPT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|