About (4S)-4-[(E)-dec-1-enyl]-2,2-dimethyl-1,3-dioxolane
(4S)-4-[(E)-dec-1-enyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 101188588) has the molecular formula C15H28O2
and a molecular weight of 240.39 g/mol. Its IUPAC name is (4S)-4-[(E)-dec-1-enyl]-2,2-dimethyl-1,3-dioxolane.
Molecular Properties
| Compound Name | (4S)-4-[(E)-dec-1-enyl]-2,2-dimethyl-1,3-dioxolane |
| PubChem CID | 101188588 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (4S)-4-[(E)-dec-1-enyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CCCCCCCC/C=C/[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C15H28O2/c1-4-5-6-7-8-9-10-11-12-14-13-16-15(2,3)17-14/h11-12,14H,4-10,13H2,1-3H3/b12-11+/t14-/m0/s1 |
| InChIKey | NDLNQTYCPRUFFO-GETOMWPZSA-N |
| XLogP | 4.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-[(E)-dec-1-enyl]-2,2-dimethyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-[(E)-dec-1-enyl]-2,2-dimethyl-1,3-dioxolane?
The IUPAC name of (4S)-4-[(E)-dec-1-enyl]-2,2-dimethyl-1,3-dioxolane (CID 101188588) is (4S)-4-[(E)-dec-1-enyl]-2,2-dimethyl-1,3-dioxolane.
What is the SMILES notation for (4S)-4-[(E)-dec-1-enyl]-2,2-dimethyl-1,3-dioxolane?
The canonical SMILES for (4S)-4-[(E)-dec-1-enyl]-2,2-dimethyl-1,3-dioxolane is CCCCCCCC/C=C/[C@H]1COC(C)(C)O1.
What is the InChIKey of (4S)-4-[(E)-dec-1-enyl]-2,2-dimethyl-1,3-dioxolane?
The InChIKey is NDLNQTYCPRUFFO-GETOMWPZSA-N. The full InChI is InChI=1S/C15H28O2/c1-4-5-6-7-8-9-10-11-12-14-13-16-15(2,3)17-14/h11-12,14H,4-10,13H2,1-3H3/b12-11+/t14-/m0/s1.
What are the key properties of (4S)-4-[(E)-dec-1-enyl]-2,2-dimethyl-1,3-dioxolane?
(4S)-4-[(E)-dec-1-enyl]-2,2-dimethyl-1,3-dioxolane has a molecular weight of 240.39 g/mol, XLogP of 4.44, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-[(E)-dec-1-enyl]-2,2-dimethyl-1,3-dioxolane is sourced from PubChem (CID 101188588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).