About di(cyclopenta-1,3-dien-1-yl)diazene
di(cyclopenta-1,3-dien-1-yl)diazene (PubChem CID 101188791) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is di(cyclopenta-1,3-dien-1-yl)diazene.
Molecular Properties
| Compound Name | di(cyclopenta-1,3-dien-1-yl)diazene |
| PubChem CID | 101188791 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | di(cyclopenta-1,3-dien-1-yl)diazene |
| SMILES | C1=CCC(/N=N/C2=CC=CC2)=C1 |
| InChI | InChI=1S/C10H10N2/c1-2-6-9(5-1)11-12-10-7-3-4-8-10/h1-5,7H,6,8H2/b12-11+ |
| InChIKey | QODUAOXUFTZJSF-VAWYXSNFSA-N |
| XLogP | 3.13 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze di(cyclopenta-1,3-dien-1-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(cyclopenta-1,3-dien-1-yl)diazene?
The IUPAC name of di(cyclopenta-1,3-dien-1-yl)diazene (CID 101188791) is di(cyclopenta-1,3-dien-1-yl)diazene.
What is the SMILES notation for di(cyclopenta-1,3-dien-1-yl)diazene?
The canonical SMILES for di(cyclopenta-1,3-dien-1-yl)diazene is C1=CCC(/N=N/C2=CC=CC2)=C1.
What is the InChIKey of di(cyclopenta-1,3-dien-1-yl)diazene?
The InChIKey is QODUAOXUFTZJSF-VAWYXSNFSA-N. The full InChI is InChI=1S/C10H10N2/c1-2-6-9(5-1)11-12-10-7-3-4-8-10/h1-5,7H,6,8H2/b12-11+.
What are the key properties of di(cyclopenta-1,3-dien-1-yl)diazene?
di(cyclopenta-1,3-dien-1-yl)diazene has a molecular weight of 158.20 g/mol, XLogP of 3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for di(cyclopenta-1,3-dien-1-yl)diazene is sourced from PubChem (CID 101188791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).