C22H20N2O7 — CID 101189030
methyl 2-[(2R,3S)-2-(3,4-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidin-1-yl]acetate (PubChem CID 101189030) has the molecular formula C22H20N2O7 and a molecular weight of 424.41 g/mol. Its IUPAC name is methyl 2-[(2R,3S)-2-(3,4-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidin-1-yl]acetate.
| Compound Name | methyl 2-[(2R,3S)-2-(3,4-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidin-1-yl]acetate |
|---|---|
| PubChem CID | 101189030 |
| Molecular Formula | C22H20N2O7 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | methyl 2-[(2R,3S)-2-(3,4-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)[C@@H](N2C(=O)c3ccccc3C2=O)[C@H]1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H20N2O7/c1-29-15-9-8-12(10-16(15)30-2)18-19(22(28)23(18)11-17(25)31-3)24-20(26)13-6-4-5-7-14(13)21(24)27/h4-10,18-19H,11H2,1-3H3/t18-,19+/m1/s1 |
| InChIKey | FJZZQESHTNXARN-MOPGFXCFSA-N |
| XLogP | 1.42 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|