C13H22O3Si — CID 101189183
(3S,5S,6aR)-3-prop-2-enoxy-4-trimethylsilyl-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-ol (PubChem CID 101189183) has the molecular formula C13H22O3Si and a molecular weight of 254.40 g/mol. Its IUPAC name is (3S,5S,6aR)-3-prop-2-enoxy-4-trimethylsilyl-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-ol.
| Compound Name | (3S,5S,6aR)-3-prop-2-enoxy-4-trimethylsilyl-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-ol |
|---|---|
| PubChem CID | 101189183 |
| Molecular Formula | C13H22O3Si |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (3S,5S,6aR)-3-prop-2-enoxy-4-trimethylsilyl-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-ol |
| SMILES | C=CCO[C@H]1OC[C@@H]2C[C@H](O)C([Si](C)(C)C)=C21 |
| InChI | InChI=1S/C13H22O3Si/c1-5-6-15-13-11-9(8-16-13)7-10(14)12(11)17(2,3)4/h5,9-10,13-14H,1,6-8H2,2-4H3/t9-,10-,13-/m0/s1 |
| InChIKey | OFVDRAFDVIBPSA-KWBADKCTSA-N |
| XLogP | 2.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|