About [(2R,3R,6S)-3-benzylsulfanyl-5-oxo-6-phenylmethoxyoxan-2-yl]methyl acetate
[(2R,3R,6S)-3-benzylsulfanyl-5-oxo-6-phenylmethoxyoxan-2-yl]methyl acetate (PubChem CID 101189197) has the molecular formula C22H24O5S
and a molecular weight of 400.50 g/mol. Its IUPAC name is [(2R,3R,6S)-3-benzylsulfanyl-5-oxo-6-phenylmethoxyoxan-2-yl]methyl acetate.
Molecular Properties
| Compound Name | [(2R,3R,6S)-3-benzylsulfanyl-5-oxo-6-phenylmethoxyoxan-2-yl]methyl acetate |
| PubChem CID | 101189197 |
| Molecular Formula | C22H24O5S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | [(2R,3R,6S)-3-benzylsulfanyl-5-oxo-6-phenylmethoxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OCc2ccccc2)C(=O)C[C@H]1SCc1ccccc1 |
| InChI | InChI=1S/C22H24O5S/c1-16(23)25-14-20-21(28-15-18-10-6-3-7-11-18)12-19(24)22(27-20)26-13-17-8-4-2-5-9-17/h2-11,20-22H,12-15H2,1H3/t20-,21-,22+/m1/s1 |
| InChIKey | WBAITQHKXCBQNC-VSKRKVRLSA-N |
| XLogP | 3.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(2R,3R,6S)-3-benzylsulfanyl-5-oxo-6-phenylmethoxyoxan-2-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R,6S)-3-benzylsulfanyl-5-oxo-6-phenylmethoxyoxan-2-yl]methyl acetate?
The IUPAC name of [(2R,3R,6S)-3-benzylsulfanyl-5-oxo-6-phenylmethoxyoxan-2-yl]methyl acetate (CID 101189197) is [(2R,3R,6S)-3-benzylsulfanyl-5-oxo-6-phenylmethoxyoxan-2-yl]methyl acetate.
What is the SMILES notation for [(2R,3R,6S)-3-benzylsulfanyl-5-oxo-6-phenylmethoxyoxan-2-yl]methyl acetate?
The canonical SMILES for [(2R,3R,6S)-3-benzylsulfanyl-5-oxo-6-phenylmethoxyoxan-2-yl]methyl acetate is CC(=O)OC[C@H]1O[C@H](OCc2ccccc2)C(=O)C[C@H]1SCc1ccccc1.
What is the InChIKey of [(2R,3R,6S)-3-benzylsulfanyl-5-oxo-6-phenylmethoxyoxan-2-yl]methyl acetate?
The InChIKey is WBAITQHKXCBQNC-VSKRKVRLSA-N. The full InChI is InChI=1S/C22H24O5S/c1-16(23)25-14-20-21(28-15-18-10-6-3-7-11-18)12-19(24)22(27-20)26-13-17-8-4-2-5-9-17/h2-11,20-22H,12-15H2,1H3/t20-,21-,22+/m1/s1.
What are the key properties of [(2R,3R,6S)-3-benzylsulfanyl-5-oxo-6-phenylmethoxyoxan-2-yl]methyl acetate?
[(2R,3R,6S)-3-benzylsulfanyl-5-oxo-6-phenylmethoxyoxan-2-yl]methyl acetate has a molecular weight of 400.50 g/mol, XLogP of 3.75, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R,6S)-3-benzylsulfanyl-5-oxo-6-phenylmethoxyoxan-2-yl]methyl acetate is sourced from PubChem (CID 101189197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).