C12H10F7O2- — CID 101189497
(1E)-2,2,3,3,4,4,4-heptafluoro-1-[(1S,4R)-4-methyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]butan-1-olate (PubChem CID 101189497) has the molecular formula C12H10F7O2- and a molecular weight of 319.20 g/mol. Its IUPAC name is (1E)-2,2,3,3,4,4,4-heptafluoro-1-[(1S,4R)-4-methyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]butan-1-olate.
| Compound Name | (1E)-2,2,3,3,4,4,4-heptafluoro-1-[(1S,4R)-4-methyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]butan-1-olate |
|---|---|
| PubChem CID | 101189497 |
| Molecular Formula | C12H10F7O2- |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | (1E)-2,2,3,3,4,4,4-heptafluoro-1-[(1S,4R)-4-methyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]butan-1-olate |
| SMILES | C[C@@]12CC[C@@H](C1)/C(=C(\[O-])C(F)(F)C(F)(F)C(F)(F)F)C2=O |
| InChI | InChI=1S/C12H11F7O2/c1-9-3-2-5(4-9)6(7(9)20)8(21)10(13,14)11(15,16)12(17,18)19/h5,21H,2-4H2,1H3/p-1/b8-6+/t5-,9+/m0/s1 |
| InChIKey | ZPUPLOFHXXAXHO-PZHMJBQLSA-M |
| XLogP | 2.82 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|