About 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonane-4,9-dione
6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonane-4,9-dione (PubChem CID 101189657) has the molecular formula C9H10O4
and a molecular weight of 182.17 g/mol. Its IUPAC name is 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonane-4,9-dione.
Analyze 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonane-4,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonane-4,9-dione?
The IUPAC name of 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonane-4,9-dione (CID 101189657) is 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonane-4,9-dione.
What is the SMILES notation for 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonane-4,9-dione?
The canonical SMILES for 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonane-4,9-dione is CC12CC(=O)C3OC(C1=O)C3(C)O2.
What is the InChIKey of 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonane-4,9-dione?
The InChIKey is JXKXKYMAVNWECK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4/c1-8-3-4(10)6-9(2,13-8)7(12-6)5(8)11/h6-7H,3H2,1-2H3.
What are the key properties of 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonane-4,9-dione?
6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonane-4,9-dione has a molecular weight of 182.17 g/mol, XLogP of -0.16, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonane-4,9-dione is sourced from PubChem (CID 101189657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).