C30H20F6OS2 — CID 101189735
3-[2-[5-(4-ethynylphenyl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-(4-methoxyphenyl)-2-methylthiophene (PubChem CID 101189735) has the molecular formula C30H20F6OS2 and a molecular weight of 574.61 g/mol. Its IUPAC name is 3-[2-[5-(4-ethynylphenyl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-(4-methoxyphenyl)-2-methylthiophene.
| Compound Name | 3-[2-[5-(4-ethynylphenyl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-(4-methoxyphenyl)-2-methylthiophene |
|---|---|
| PubChem CID | 101189735 |
| Molecular Formula | C30H20F6OS2 |
| Molecular Weight | 574.61 g/mol |
| Exact Mass | 574.09 |
| IUPAC Name | 3-[2-[5-(4-ethynylphenyl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-(4-methoxyphenyl)-2-methylthiophene |
| SMILES | C#Cc1ccc(-c2cc(C3=C(c4cc(-c5ccc(OC)cc5)sc4C)C(F)(F)C(F)(F)C3(F)F)c(C)s2)cc1 |
| InChI | InChI=1S/C30H20F6OS2/c1-5-18-6-8-19(9-7-18)24-14-22(16(2)38-24)26-27(29(33,34)30(35,36)28(26,31)32)23-15-25(39-17(23)3)20-10-12-21(37-4)13-11-20/h1,6-15H,2-4H3 |
| InChIKey | BZNDJAOJYOPIFR-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.61 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|