C12H18O4 — CID 101189786
ethyl (1R,2S,4S)-1-(hydroxymethyl)-3,3-dimethyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 101189786) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is ethyl (1R,2S,4S)-1-(hydroxymethyl)-3,3-dimethyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | ethyl (1R,2S,4S)-1-(hydroxymethyl)-3,3-dimethyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 101189786 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | ethyl (1R,2S,4S)-1-(hydroxymethyl)-3,3-dimethyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(C)(C)[C@@H]2C=C[C@@]1(CO)O2 |
| InChI | InChI=1S/C12H18O4/c1-4-15-10(14)9-11(2,3)8-5-6-12(9,7-13)16-8/h5-6,8-9,13H,4,7H2,1-3H3/t8-,9-,12-/m0/s1 |
| InChIKey | IJGHKHPNJFTMKT-AUTRQRHGSA-N |
| XLogP | 0.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|