C10H14O — CID 101190094
(3aE,6Z)-1,3,5,8,9,9a-hexahydrocycloocta[c]furan (PubChem CID 101190094) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is (3aE,6Z)-1,3,5,8,9,9a-hexahydrocycloocta[c]furan.
| Compound Name | (3aE,6Z)-1,3,5,8,9,9a-hexahydrocycloocta[c]furan |
|---|---|
| PubChem CID | 101190094 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (3aE,6Z)-1,3,5,8,9,9a-hexahydrocycloocta[c]furan |
| SMILES | C1=C\CCC2COC/C2=C/C/1 |
| InChI | InChI=1S/C10H14O/c1-2-4-6-10-8-11-7-9(10)5-3-1/h1-2,5,10H,3-4,6-8H2/b2-1-,9-5- |
| InChIKey | BARNBZDPIOVFFZ-HBRSPCJUSA-N |
| XLogP | 2.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|