About [(1R)-4,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl] ethyl carbonate
[(1R)-4,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl] ethyl carbonate (PubChem CID 101190415) has the molecular formula C22H44O5Si2
and a molecular weight of 444.76 g/mol. Its IUPAC name is [(1R)-4,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl] ethyl carbonate.
Molecular Properties
| Compound Name | [(1R)-4,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl] ethyl carbonate |
| PubChem CID | 101190415 |
| Molecular Formula | C22H44O5Si2 |
| Molecular Weight | 444.76 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | [(1R)-4,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl] ethyl carbonate |
| SMILES | CCOC(=O)O[C@H]1C=CC(CO[Si](C)(C)C(C)(C)C)(CO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C22H44O5Si2/c1-12-24-19(23)27-18-13-14-22(15-18,16-25-28(8,9)20(2,3)4)17-26-29(10,11)21(5,6)7/h13-14,18H,12,15-17H2,1-11H3/t18-/m0/s1 |
| InChIKey | OFKGERIEASGGQB-SFHVURJKSA-N |
| XLogP | 6.52 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.76 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-4,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-4,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl] ethyl carbonate?
The IUPAC name of [(1R)-4,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl] ethyl carbonate (CID 101190415) is [(1R)-4,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl] ethyl carbonate.
What is the SMILES notation for [(1R)-4,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl] ethyl carbonate?
The canonical SMILES for [(1R)-4,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl] ethyl carbonate is CCOC(=O)O[C@H]1C=CC(CO[Si](C)(C)C(C)(C)C)(CO[Si](C)(C)C(C)(C)C)C1.
What is the InChIKey of [(1R)-4,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl] ethyl carbonate?
The InChIKey is OFKGERIEASGGQB-SFHVURJKSA-N. The full InChI is InChI=1S/C22H44O5Si2/c1-12-24-19(23)27-18-13-14-22(15-18,16-25-28(8,9)20(2,3)4)17-26-29(10,11)21(5,6)7/h13-14,18H,12,15-17H2,1-11H3/t18-/m0/s1.
What are the key properties of [(1R)-4,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl] ethyl carbonate?
[(1R)-4,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl] ethyl carbonate has a molecular weight of 444.76 g/mol, XLogP of 6.52, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-4,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl] ethyl carbonate is sourced from PubChem (CID 101190415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).