About N-phenyl-1-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfinylnaphthalen-2-yl]methanimine
N-phenyl-1-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfinylnaphthalen-2-yl]methanimine (PubChem CID 101191380) has the molecular formula C32H35NOS
and a molecular weight of 481.71 g/mol. Its IUPAC name is N-phenyl-1-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfinylnaphthalen-2-yl]methanimine.
Molecular Properties
| Compound Name | N-phenyl-1-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfinylnaphthalen-2-yl]methanimine |
| PubChem CID | 101191380 |
| Molecular Formula | C32H35NOS |
| Molecular Weight | 481.71 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | N-phenyl-1-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfinylnaphthalen-2-yl]methanimine |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)c2c(/C=N\c3ccccc3)ccc3ccccc23)c(C(C)C)c1 |
| InChI | InChI=1S/C32H35NOS/c1-21(2)26-18-29(22(3)4)32(30(19-26)23(5)6)35(34)31-25(20-33-27-13-8-7-9-14-27)17-16-24-12-10-11-15-28(24)31/h7-23H,1-6H3/b33-20- |
| InChIKey | DCEWHEXHZUINTJ-UCMJSZAQSA-N |
| XLogP | 9.13 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.71 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-phenyl-1-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfinylnaphthalen-2-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-1-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfinylnaphthalen-2-yl]methanimine?
The IUPAC name of N-phenyl-1-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfinylnaphthalen-2-yl]methanimine (CID 101191380) is N-phenyl-1-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfinylnaphthalen-2-yl]methanimine.
What is the SMILES notation for N-phenyl-1-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfinylnaphthalen-2-yl]methanimine?
The canonical SMILES for N-phenyl-1-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfinylnaphthalen-2-yl]methanimine is CC(C)c1cc(C(C)C)c(S(=O)c2c(/C=N\c3ccccc3)ccc3ccccc23)c(C(C)C)c1.
What is the InChIKey of N-phenyl-1-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfinylnaphthalen-2-yl]methanimine?
The InChIKey is DCEWHEXHZUINTJ-UCMJSZAQSA-N. The full InChI is InChI=1S/C32H35NOS/c1-21(2)26-18-29(22(3)4)32(30(19-26)23(5)6)35(34)31-25(20-33-27-13-8-7-9-14-27)17-16-24-12-10-11-15-28(24)31/h7-23H,1-6H3/b33-20-.
What are the key properties of N-phenyl-1-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfinylnaphthalen-2-yl]methanimine?
N-phenyl-1-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfinylnaphthalen-2-yl]methanimine has a molecular weight of 481.71 g/mol, XLogP of 9.13, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-1-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfinylnaphthalen-2-yl]methanimine is sourced from PubChem (CID 101191380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).