C9H14Cl3NO2 — CID 101191823
[(2S,3S)-3-(2-methylpropyl)oxiran-2-yl]methyl 2,2,2-trichloroethanimidate (PubChem CID 101191823) has the molecular formula C9H14Cl3NO2 and a molecular weight of 274.57 g/mol. Its IUPAC name is [(2S,3S)-3-(2-methylpropyl)oxiran-2-yl]methyl 2,2,2-trichloroethanimidate.
| Compound Name | [(2S,3S)-3-(2-methylpropyl)oxiran-2-yl]methyl 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 101191823 |
| Molecular Formula | C9H14Cl3NO2 |
| Molecular Weight | 274.57 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | [(2S,3S)-3-(2-methylpropyl)oxiran-2-yl]methyl 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC[C@@H]1O[C@H]1CC(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H14Cl3NO2/c1-5(2)3-6-7(15-6)4-14-8(13)9(10,11)12/h5-7,13H,3-4H2,1-2H3/b13-8+/t6-,7-/m0/s1 |
| InChIKey | WFFOWGFFFQQLMH-VEJJNZQJSA-N |
| XLogP | 3.16 |
| TPSA | 45.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|