C19H14BrNO2 — CID 101192266
10-bromo-3,6,14-trimethyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione (PubChem CID 101192266) has the molecular formula C19H14BrNO2 and a molecular weight of 368.23 g/mol. Its IUPAC name is 10-bromo-3,6,14-trimethyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione.
| Compound Name | 10-bromo-3,6,14-trimethyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione |
|---|---|
| PubChem CID | 101192266 |
| Molecular Formula | C19H14BrNO2 |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 10-bromo-3,6,14-trimethyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione |
| SMILES | Cc1ccc(C)c2c1C(=O)c1c(Br)ccc3c1c-2cc(=O)n3C |
| InChI | InChI=1S/C19H14BrNO2/c1-9-4-5-10(2)16-15(9)11-8-14(22)21(3)13-7-6-12(20)18(17(11)13)19(16)23/h4-8H,1-3H3 |
| InChIKey | KCPKLJRZXNOAHP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |