C24H14N2O3 — CID 101192267
14-methyl-3,14-diazahexacyclo[11.11.1.02,11.04,9.017,25.018,23]pentacosa-1,4,6,8,11,13(25),16,18,20,22-decaene-10,15,24-trione (PubChem CID 101192267) has the molecular formula C24H14N2O3 and a molecular weight of 378.39 g/mol. Its IUPAC name is 14-methyl-3,14-diazahexacyclo[11.11.1.02,11.04,9.017,25.018,23]pentacosa-1,4,6,8,11,13(25),16,18,20,22-decaene-10,15,24-trione.
| Compound Name | 14-methyl-3,14-diazahexacyclo[11.11.1.02,11.04,9.017,25.018,23]pentacosa-1,4,6,8,11,13(25),16,18,20,22-decaene-10,15,24-trione |
|---|---|
| PubChem CID | 101192267 |
| Molecular Formula | C24H14N2O3 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 14-methyl-3,14-diazahexacyclo[11.11.1.02,11.04,9.017,25.018,23]pentacosa-1,4,6,8,11,13(25),16,18,20,22-decaene-10,15,24-trione |
| SMILES | Cn1c(=O)cc2c3c(c4[nH]c5ccccc5c(=O)c4cc31)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C24H14N2O3/c1-26-18-10-16-22(25-17-9-5-4-8-14(17)23(16)28)21-20(18)15(11-19(26)27)12-6-2-3-7-13(12)24(21)29/h2-11H,1H3,(H,25,28) |
| InChIKey | GVOROAUHIACMKW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|