About methyl 1-diphenylphosphoryl-3-methylbuta-1,2-diene-1-sulfinate
methyl 1-diphenylphosphoryl-3-methylbuta-1,2-diene-1-sulfinate (PubChem CID 101192373) has the molecular formula C18H19O3PS
and a molecular weight of 346.39 g/mol. Its IUPAC name is methyl 1-diphenylphosphoryl-3-methylbuta-1,2-diene-1-sulfinate.
Molecular Properties
| Compound Name | methyl 1-diphenylphosphoryl-3-methylbuta-1,2-diene-1-sulfinate |
| PubChem CID | 101192373 |
| Molecular Formula | C18H19O3PS |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | methyl 1-diphenylphosphoryl-3-methylbuta-1,2-diene-1-sulfinate |
| SMILES | COS(=O)C(=C=C(C)C)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19O3PS/c1-15(2)14-18(23(20)21-3)22(19,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13H,1-3H3 |
| InChIKey | KQBQODGNTBILKA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-diphenylphosphoryl-3-methylbuta-1,2-diene-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-diphenylphosphoryl-3-methylbuta-1,2-diene-1-sulfinate?
The IUPAC name of methyl 1-diphenylphosphoryl-3-methylbuta-1,2-diene-1-sulfinate (CID 101192373) is methyl 1-diphenylphosphoryl-3-methylbuta-1,2-diene-1-sulfinate.
What is the SMILES notation for methyl 1-diphenylphosphoryl-3-methylbuta-1,2-diene-1-sulfinate?
The canonical SMILES for methyl 1-diphenylphosphoryl-3-methylbuta-1,2-diene-1-sulfinate is COS(=O)C(=C=C(C)C)P(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl 1-diphenylphosphoryl-3-methylbuta-1,2-diene-1-sulfinate?
The InChIKey is KQBQODGNTBILKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19O3PS/c1-15(2)14-18(23(20)21-3)22(19,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13H,1-3H3.
What are the key properties of methyl 1-diphenylphosphoryl-3-methylbuta-1,2-diene-1-sulfinate?
methyl 1-diphenylphosphoryl-3-methylbuta-1,2-diene-1-sulfinate has a molecular weight of 346.39 g/mol, XLogP of 3.72, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-diphenylphosphoryl-3-methylbuta-1,2-diene-1-sulfinate is sourced from PubChem (CID 101192373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).