About 7-methylidene-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene
7-methylidene-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene (PubChem CID 101192510) has the molecular formula C13H16N+
and a molecular weight of 186.28 g/mol. Its IUPAC name is 7-methylidene-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene.
Molecular Properties
| Compound Name | 7-methylidene-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene |
| PubChem CID | 101192510 |
| Molecular Formula | C13H16N+ |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 7-methylidene-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene |
| SMILES | C=c1cc2c3c(c1)CCC[N+]=3CCC2 |
| InChI | InChI=1S/C13H16N/c1-10-8-11-4-2-6-14-7-3-5-12(9-10)13(11)14/h8-9H,1-7H2/q+1 |
| InChIKey | QKQRJLMRFQORJU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7-methylidene-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylidene-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene?
The IUPAC name of 7-methylidene-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene (CID 101192510) is 7-methylidene-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene.
What is the SMILES notation for 7-methylidene-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene?
The canonical SMILES for 7-methylidene-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene is C=c1cc2c3c(c1)CCC[N+]=3CCC2.
What is the InChIKey of 7-methylidene-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene?
The InChIKey is QKQRJLMRFQORJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N/c1-10-8-11-4-2-6-14-7-3-5-12(9-10)13(11)14/h8-9H,1-7H2/q+1.
What are the key properties of 7-methylidene-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene?
7-methylidene-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene has a molecular weight of 186.28 g/mol, XLogP of 0.48, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylidene-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene is sourced from PubChem (CID 101192510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).