About 5-(4-methoxyphenyl)-2,3-dihydrofuran
5-(4-methoxyphenyl)-2,3-dihydrofuran (PubChem CID 101192836) has the molecular formula C11H12O2
and a molecular weight of 176.21 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 5-(4-methoxyphenyl)-2,3-dihydrofuran |
| PubChem CID | 101192836 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 5-(4-methoxyphenyl)-2,3-dihydrofuran |
| SMILES | COc1ccc(C2=CCCO2)cc1 |
| InChI | InChI=1S/C11H12O2/c1-12-10-6-4-9(5-7-10)11-3-2-8-13-11/h3-7H,2,8H2,1H3 |
| InChIKey | ZBNAMXPKAROVDE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-methoxyphenyl)-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methoxyphenyl)-2,3-dihydrofuran?
The IUPAC name of 5-(4-methoxyphenyl)-2,3-dihydrofuran (CID 101192836) is 5-(4-methoxyphenyl)-2,3-dihydrofuran.
What is the SMILES notation for 5-(4-methoxyphenyl)-2,3-dihydrofuran?
The canonical SMILES for 5-(4-methoxyphenyl)-2,3-dihydrofuran is COc1ccc(C2=CCCO2)cc1.
What is the InChIKey of 5-(4-methoxyphenyl)-2,3-dihydrofuran?
The InChIKey is ZBNAMXPKAROVDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2/c1-12-10-6-4-9(5-7-10)11-3-2-8-13-11/h3-7H,2,8H2,1H3.
What are the key properties of 5-(4-methoxyphenyl)-2,3-dihydrofuran?
5-(4-methoxyphenyl)-2,3-dihydrofuran has a molecular weight of 176.21 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methoxyphenyl)-2,3-dihydrofuran is sourced from PubChem (CID 101192836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).