C11H12O2 — CID 101192836
5-(4-methoxyphenyl)-2,3-dihydrofuran (PubChem CID 101192836) has the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2,3-dihydrofuran.
| Compound Name | 5-(4-methoxyphenyl)-2,3-dihydrofuran |
|---|---|
| PubChem CID | 101192836 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 5-(4-methoxyphenyl)-2,3-dihydrofuran |
| SMILES | COc1ccc(C2=CCCO2)cc1 |
| InChI | InChI=1S/C11H12O2/c1-12-10-6-4-9(5-7-10)11-3-2-8-13-11/h3-7H,2,8H2,1H3 |
| InChIKey | ZBNAMXPKAROVDE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |