C26H30N4O5 — CID 101193204
dimethyl (1R,5S)-7-cyclobutyl-3-methyl-9-oxo-2,4-dipyridin-2-yl-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate (PubChem CID 101193204) has the molecular formula C26H30N4O5 and a molecular weight of 478.55 g/mol. Its IUPAC name is dimethyl (1R,5S)-7-cyclobutyl-3-methyl-9-oxo-2,4-dipyridin-2-yl-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate.
| Compound Name | dimethyl (1R,5S)-7-cyclobutyl-3-methyl-9-oxo-2,4-dipyridin-2-yl-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate |
|---|---|
| PubChem CID | 101193204 |
| Molecular Formula | C26H30N4O5 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | dimethyl (1R,5S)-7-cyclobutyl-3-methyl-9-oxo-2,4-dipyridin-2-yl-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate |
| SMILES | COC(=O)[C@@]12CN(C3CCC3)C[C@@](C(=O)OC)(C1=O)C(c1ccccn1)N(C)C2c1ccccn1 |
| InChI | InChI=1S/C26H30N4O5/c1-29-20(18-11-4-6-13-27-18)25(23(32)34-2)15-30(17-9-8-10-17)16-26(22(25)31,24(33)35-3)21(29)19-12-5-7-14-28-19/h4-7,11-14,17,20-21H,8-10,15-16H2,1-3H3/t20?,21?,25-,26+ |
| InChIKey | JPSVQIHFZPVYQP-HWUWZZFZSA-N |
| XLogP | 1.96 |
| TPSA | 101.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|