C19H20O2 — CID 101193353
2,2-dimethyl-5-[(E)-2-phenylethenyl]-3,4-dihydrochromen-7-ol (PubChem CID 101193353) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2,2-dimethyl-5-[(E)-2-phenylethenyl]-3,4-dihydrochromen-7-ol.
| Compound Name | 2,2-dimethyl-5-[(E)-2-phenylethenyl]-3,4-dihydrochromen-7-ol |
|---|---|
| PubChem CID | 101193353 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 2,2-dimethyl-5-[(E)-2-phenylethenyl]-3,4-dihydrochromen-7-ol |
| SMILES | CC1(C)CCc2c(/C=C/c3ccccc3)cc(O)cc2O1 |
| InChI | InChI=1S/C19H20O2/c1-19(2)11-10-17-15(12-16(20)13-18(17)21-19)9-8-14-6-4-3-5-7-14/h3-9,12-13,20H,10-11H2,1-2H3/b9-8+ |
| InChIKey | YUTDNNDOFVJHRL-CMDGGOBGSA-N |
| XLogP | 4.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|