About [[4-[(E)-2-benzoyl-2,5-diphenylpent-4-enyl]phenyl]-difluoromethyl]phosphonic acid
[[4-[(E)-2-benzoyl-2,5-diphenylpent-4-enyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 10119338) has the molecular formula C31H27F2O4P
and a molecular weight of 532.52 g/mol. Its IUPAC name is [[4-[(E)-2-benzoyl-2,5-diphenylpent-4-enyl]phenyl]-difluoromethyl]phosphonic acid.
Molecular Properties
| Compound Name | [[4-[(E)-2-benzoyl-2,5-diphenylpent-4-enyl]phenyl]-difluoromethyl]phosphonic acid |
| PubChem CID | 10119338 |
| Molecular Formula | C31H27F2O4P |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | [[4-[(E)-2-benzoyl-2,5-diphenylpent-4-enyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | O=C(c1ccccc1)C(C/C=C/c1ccccc1)(Cc1ccc(C(F)(F)P(=O)(O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H27F2O4P/c32-31(33,38(35,36)37)28-20-18-25(19-21-28)23-30(27-16-8-3-9-17-27,29(34)26-14-6-2-7-15-26)22-10-13-24-11-4-1-5-12-24/h1-21H,22-23H2,(H2,35,36,37)/b13-10+ |
| InChIKey | YXZIPKWVAWBGPL-JLHYYAGUSA-N |
| XLogP | 7.38 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [[4-[(E)-2-benzoyl-2,5-diphenylpent-4-enyl]phenyl]-difluoromethyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[4-[(E)-2-benzoyl-2,5-diphenylpent-4-enyl]phenyl]-difluoromethyl]phosphonic acid?
The IUPAC name of [[4-[(E)-2-benzoyl-2,5-diphenylpent-4-enyl]phenyl]-difluoromethyl]phosphonic acid (CID 10119338) is [[4-[(E)-2-benzoyl-2,5-diphenylpent-4-enyl]phenyl]-difluoromethyl]phosphonic acid.
What is the SMILES notation for [[4-[(E)-2-benzoyl-2,5-diphenylpent-4-enyl]phenyl]-difluoromethyl]phosphonic acid?
The canonical SMILES for [[4-[(E)-2-benzoyl-2,5-diphenylpent-4-enyl]phenyl]-difluoromethyl]phosphonic acid is O=C(c1ccccc1)C(C/C=C/c1ccccc1)(Cc1ccc(C(F)(F)P(=O)(O)O)cc1)c1ccccc1.
What is the InChIKey of [[4-[(E)-2-benzoyl-2,5-diphenylpent-4-enyl]phenyl]-difluoromethyl]phosphonic acid?
The InChIKey is YXZIPKWVAWBGPL-JLHYYAGUSA-N. The full InChI is InChI=1S/C31H27F2O4P/c32-31(33,38(35,36)37)28-20-18-25(19-21-28)23-30(27-16-8-3-9-17-27,29(34)26-14-6-2-7-15-26)22-10-13-24-11-4-1-5-12-24/h1-21H,22-23H2,(H2,35,36,37)/b13-10+.
What are the key properties of [[4-[(E)-2-benzoyl-2,5-diphenylpent-4-enyl]phenyl]-difluoromethyl]phosphonic acid?
[[4-[(E)-2-benzoyl-2,5-diphenylpent-4-enyl]phenyl]-difluoromethyl]phosphonic acid has a molecular weight of 532.52 g/mol, XLogP of 7.38, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [[4-[(E)-2-benzoyl-2,5-diphenylpent-4-enyl]phenyl]-difluoromethyl]phosphonic acid is sourced from PubChem (CID 10119338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).