C12H13FNO2+ — CID 101193737
1-(2-fluorophenyl)-2-(2-methyl-4,5-dihydro-1,2-oxazol-2-ium-3-yl)ethanone (PubChem CID 101193737) has the molecular formula C12H13FNO2+ and a molecular weight of 222.24 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-2-(2-methyl-4,5-dihydro-1,2-oxazol-2-ium-3-yl)ethanone.
| Compound Name | 1-(2-fluorophenyl)-2-(2-methyl-4,5-dihydro-1,2-oxazol-2-ium-3-yl)ethanone |
|---|---|
| PubChem CID | 101193737 |
| Molecular Formula | C12H13FNO2+ |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 1-(2-fluorophenyl)-2-(2-methyl-4,5-dihydro-1,2-oxazol-2-ium-3-yl)ethanone |
| SMILES | C[N+]1=C(CC(=O)c2ccccc2F)CCO1 |
| InChI | InChI=1S/C12H13FNO2/c1-14-9(6-7-16-14)8-12(15)10-4-2-3-5-11(10)13/h2-5H,6-8H2,1H3/q+1 |
| InChIKey | MKJMOOFPZPLWEK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|