C21H42O3Si2 — CID 101193985
tert-butyl-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(6R)-3,6-dihydro-2H-pyran-6-yl]but-3-enoxy]-dimethylsilane (PubChem CID 101193985) has the molecular formula C21H42O3Si2 and a molecular weight of 398.74 g/mol. Its IUPAC name is tert-butyl-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(6R)-3,6-dihydro-2H-pyran-6-yl]but-3-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(6R)-3,6-dihydro-2H-pyran-6-yl]but-3-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101193985 |
| Molecular Formula | C21H42O3Si2 |
| Molecular Weight | 398.74 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | tert-butyl-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(6R)-3,6-dihydro-2H-pyran-6-yl]but-3-enoxy]-dimethylsilane |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C=CCCO1 |
| InChI | InChI=1S/C21H42O3Si2/c1-12-17(23-25(8,9)20(2,3)4)19(18-15-13-14-16-22-18)24-26(10,11)21(5,6)7/h12-13,15,17-19H,1,14,16H2,2-11H3/t17-,18-,19-/m1/s1 |
| InChIKey | PJSMFWSHXLJOSD-GUDVDZBRSA-N |
| XLogP | 6.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.74 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|