About (2R,3S)-2-ethenyl-1,3-dimethylaziridine
(2R,3S)-2-ethenyl-1,3-dimethylaziridine (PubChem CID 101194098) has the molecular formula C6H11N
and a molecular weight of 97.16 g/mol. Its IUPAC name is (2R,3S)-2-ethenyl-1,3-dimethylaziridine.
Molecular Properties
| Compound Name | (2R,3S)-2-ethenyl-1,3-dimethylaziridine |
| PubChem CID | 101194098 |
| Molecular Formula | C6H11N |
| Molecular Weight | 97.16 g/mol |
| Exact Mass | 97.09 |
| IUPAC Name | (2R,3S)-2-ethenyl-1,3-dimethylaziridine |
| SMILES | C=C[C@@H]1[C@H](C)N1C |
| InChI | InChI=1S/C6H11N/c1-4-6-5(2)7(6)3/h4-6H,1H2,2-3H3/t5-,6+,7?/m0/s1 |
| InChIKey | JREUOYRYQGTZQV-GFCOJPQKSA-N |
| XLogP | 0.87 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.16 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-2-ethenyl-1,3-dimethylaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-2-ethenyl-1,3-dimethylaziridine?
The IUPAC name of (2R,3S)-2-ethenyl-1,3-dimethylaziridine (CID 101194098) is (2R,3S)-2-ethenyl-1,3-dimethylaziridine.
What is the SMILES notation for (2R,3S)-2-ethenyl-1,3-dimethylaziridine?
The canonical SMILES for (2R,3S)-2-ethenyl-1,3-dimethylaziridine is C=C[C@@H]1[C@H](C)N1C.
What is the InChIKey of (2R,3S)-2-ethenyl-1,3-dimethylaziridine?
The InChIKey is JREUOYRYQGTZQV-GFCOJPQKSA-N. The full InChI is InChI=1S/C6H11N/c1-4-6-5(2)7(6)3/h4-6H,1H2,2-3H3/t5-,6+,7?/m0/s1.
What are the key properties of (2R,3S)-2-ethenyl-1,3-dimethylaziridine?
(2R,3S)-2-ethenyl-1,3-dimethylaziridine has a molecular weight of 97.16 g/mol, XLogP of 0.87, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2-ethenyl-1,3-dimethylaziridine is sourced from PubChem (CID 101194098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).